14360-50-0 n-Amyl 2-furyl ketone
| produktnavn |
n-Amyl 2-furyl ketone |
| Engelsk navn |
n-Amyl 2-furyl ketone; 2-Furyl Pentyl Ketone; 2-Hexanoylfuran; n-Amyl 2-furyl ketone~2-Furyl n-pentyl ketone; 1-(furan-2-yl)hexan-1-one; 1-furan-2-ylhexan-2-one |
| Molekylær Formel |
C10H14O2 |
| Molekylvekt |
166.217 |
| InChI |
InChI=1/C10H14O2/c1-2-3-5-9(11)8-10-6-4-7-12-10/h4,6-7H,2-3,5,8H2,1H3 |
| CAS-nummer |
14360-50-0 |
| EINECS |
238-333-0 |
| Molecular Structure |
|
| Tetthet |
0.988g/cm3 |
| Kokepunkt |
228.3°C at 760 mmHg |
| Brytningsindeks |
1.466 |
| Flammepunktet |
97.4°C |
| Damptrykk |
0.0741mmHg at 25°C |
| Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|