ChemNet > CAS > 14360-50-0 n-Amyl 2-furyl ketone
14360-50-0 n-Amyl 2-furyl ketone
상품명칭 |
n-Amyl 2-furyl ketone |
별명 |
2-Furyl Pentyl Ketone; 2-Hexanoylfuran; n-Amyl 2-furyl ketone~2-Furyl n-pentyl ketone; 1-(furan-2-yl)hexan-1-one; 1-furan-2-ylhexan-2-one |
분자식 |
C10H14O2 |
분자량 |
166.217 |
InChI |
InChI=1/C10H14O2/c1-2-3-5-9(11)8-10-6-4-7-12-10/h4,6-7H,2-3,5,8H2,1H3 |
cas번호 |
14360-50-0 |
EC번호 |
238-333-0 |
분자 구조 |
|
밀도 |
0.988g/cm3 |
비등점 |
228.3°C at 760 mmHg |
굴절 지수 |
1.466 |
인화점 |
97.4°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|