4917-76-4 thiodi(succinic acid)
Ονομασία του προϊόντος |
thiodi(succinic acid) |
Αγγλικό όνομα |
thiodi(succinic acid); Thiodisuccinicacid; Thiodisuccinic acid; 2,2'-sulfanediyldibutanedioic acid |
MF |
C7H5FN2 |
Μοριακό βάρος |
136.1264 |
InChI |
InChI=1/C7H5FN2/c8-6-2-4-10-7-5(6)1-3-9-7/h1-4H,(H,9,10) |
CAS ΟΧΙ |
4917-76-4 |
EINECS |
225-544-8 |
Μοριακή δομή |
|
Πυκνότητα |
1.371g/cm3 |
Δείκτης διάθλασης |
1.659 |
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|