4917-76-4 thiodi(succinic acid)
उत्पाद का नाम |
thiodi(succinic acid) |
अंग्रेजी नाम |
thiodi(succinic acid); Thiodisuccinicacid; Thiodisuccinic acid; 2,2'-sulfanediyldibutanedioic acid |
आणविक फार्मूला |
C7H5FN2 |
आण्विक वजन |
136.1264 |
InChI |
InChI=1/C7H5FN2/c8-6-2-4-10-7-5(6)1-3-9-7/h1-4H,(H,9,10) |
कैस रजिस्टी संख्या |
4917-76-4 |
EINECS |
225-544-8 |
आणविक संरचना |
|
घनत्व |
1.371g/cm3 |
अपवर्तक सूचकांक |
1.659 |
खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|