ChemNet > CAS > 4917-76-4 thiodi(succinic acid)
4917-76-4 thiodi(succinic acid)
اسم المنتج |
thiodi(succinic acid) |
الاسم المستعار |
Thiodisuccinicacid; Thiodisuccinic acid; 2,2'-sulfanediyldibutanedioic acid |
الصيغة الجزيئية |
C7H5FN2 |
الوزن الجزيئي الغرامي |
136.1264 |
InChI |
InChI=1/C7H5FN2/c8-6-2-4-10-7-5(6)1-3-9-7/h1-4H,(H,9,10) |
إستراتيجية المساعدة القطرية |
4917-76-4 |
المفوضية الأوروبية رقم |
225-544-8 |
بنية جزيئية |
|
كثافة |
1.371g/cm3 |
معامل الإنكسار |
1.659 |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|