ChemNet > CAS > 5407-98-7 cyclobutyl phenyl ketone
5407-98-7 cyclobutyl phenyl ketone
termék neve |
cyclobutyl phenyl ketone |
Angol név |
cyclobutyl phenyl ketone; Benzoylcyclobutane; cyclobutyl(phenyl)methanone |
MF |
C11H12O |
Molekulatömeg |
160.2124 |
InChI |
InChI=1/C11H12O/c12-11(10-7-4-8-10)9-5-2-1-3-6-9/h1-3,5-6,10H,4,7-8H2 |
CAS-szám |
5407-98-7 |
EINECS |
226-473-5 |
Molekuláris szerkezete |
|
Sűrűség |
1.082g/cm3 |
Forráspont |
260°C at 760 mmHg |
Törésmutató |
1.563 |
Gyulladáspont |
102.5°C |
Gőznyomás |
0.0125mmHg at 25°C |
Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|