ChemNet > CAS > 5407-98-7 cyclobutyl phenyl ketone
5407-98-7 cyclobutyl phenyl ketone
Naam product |
cyclobutyl phenyl ketone |
Synoniemen |
Benzoylcyclobutane; cyclobutyl(phenyl)methanone |
MF |
C11H12O |
Molecuulgewicht |
160.2124 |
InChI |
InChI=1/C11H12O/c12-11(10-7-4-8-10)9-5-2-1-3-6-9/h1-3,5-6,10H,4,7-8H2 |
CAS-nummer |
5407-98-7 |
EINECS |
226-473-5 |
Moleculaire Structuur |
|
Dichtheid |
1.082g/cm3 |
Kookpunt |
260°C at 760 mmHg |
Brekingsindex |
1.563 |
Vlampunt |
102.5°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|