ChemNet > CAS > 618-76-8 4-hydroxy-3,5-diiodobenzoic acid
618-76-8 4-hydroxy-3,5-diiodobenzoic acid
termék neve |
4-hydroxy-3,5-diiodobenzoic acid |
Angol név |
4-hydroxy-3,5-diiodobenzoic acid; 3,5-Diiodo-4-hydroxybenzoic acid |
MF |
C7H4I2O3 |
Molekulatömeg |
389.9138 |
InChI |
InChI=1/C7H4I2O3/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2,10H,(H,11,12) |
CAS-szám |
618-76-8 |
EINECS |
210-562-0 |
Molekuláris szerkezete |
|
Sűrűség |
2.697g/cm3 |
Forráspont |
346.4°C at 760 mmHg |
Törésmutató |
1.784 |
Gyulladáspont |
163.3°C |
Gőznyomás |
2.19E-05mmHg at 25°C |
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|