69321-60-4 2,6-Dibromotoluene
Nama produk |
2,6-Dibromotoluene |
Nama bahasa Inggris |
2,6-Dibromotoluene; 1,3-dibromo-2-methylbenzene |
MF |
C7H6Br2 |
Berat Molekul |
249.9305 |
InChI |
InChI=1/C7H6Br2/c1-5-6(8)3-2-4-7(5)9/h2-4H,1H3 |
CAS NO |
69321-60-4 |
Struktur Molekul |
|
Kepadatan |
1.81g/cm3 |
Titik didih |
246°C at 760 mmHg |
Indeks bias |
1.587 |
Titik nyala |
106.6°C |
Tekanan uap |
0.0436mmHg at 25°C |
Kode Risiko |
R36/38:Irritating to eyes and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|