69321-60-4 2,6-Dibromotoluene
שם המוצר |
2,6-Dibromotoluene |
שם אנגלי |
2,6-Dibromotoluene; 1,3-dibromo-2-methylbenzene |
מולקולרית פורמולה |
C7H6Br2 |
משקל מולקולרי |
249.9305 |
InChI |
InChI=1/C7H6Br2/c1-5-6(8)3-2-4-7(5)9/h2-4H,1H3 |
מספר CAS |
69321-60-4 |
מבנה מולקולרי |
|
צפיפות |
1.81g/cm3 |
נקודת רתיחה |
246°C at 760 mmHg |
משקל סגולי |
1.587 |
נקודת הבזק |
106.6°C |
לחץ אדים |
0.0436mmHg at 25°C |
סיכונים קודי |
R36/38:Irritating to eyes and skin.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|