69321-60-4 2,6-Dibromotoluene
اسم المنتج |
2,6-Dibromotoluene |
الاسم بالانجليزية |
2,6-Dibromotoluene; 1,3-dibromo-2-methylbenzene |
الصيغة الجزيئية |
C7H6Br2 |
الوزن الجزيئي الغرامي |
249.9305 |
InChI |
InChI=1/C7H6Br2/c1-5-6(8)3-2-4-7(5)9/h2-4H,1H3 |
إستراتيجية المساعدة القطرية |
69321-60-4 |
بنية جزيئية |
|
كثافة |
1.81g/cm3 |
نقطة الغليان |
246°C at 760 mmHg |
معامل الإنكسار |
1.587 |
نقطة الوميض |
106.6°C |
ضغط البخار |
0.0436mmHg at 25°C |
خطر المصطلحات |
R36/38:Irritating to eyes and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|