ChemNet > CAS > 6326-14-3 2,4-Dichlorophenylthiourae
6326-14-3 2,4-Dichlorophenylthiourae
שם המוצר |
2,4-Dichlorophenylthiourae |
שם אנגלי |
2,4-Dichlorophenylthiourae; |
מולקולרית פורמולה |
C7H6Cl2N2S |
משקל מולקולרי |
221.1069 |
InChI |
InChI=1/C7H6Cl2N2S/c8-4-1-2-6(5(9)3-4)11-7(10)12/h1-3H,(H3,10,11,12) |
מספר CAS |
6326-14-3 |
מבנה מולקולרי |
|
צפיפות |
1.563g/cm3 |
נקודת רתיחה |
321.8°C at 760 mmHg |
משקל סגולי |
1.73 |
נקודת הבזק |
148.4°C |
לחץ אדים |
0.000292mmHg at 25°C |
סיכונים קודי |
R20/22:Harmful by inhalation and if swallowed.;
|
בטיחות תיאור |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|