ChemNet > CAS > 6326-14-3 2,4-Dichlorophenylthiourae
6326-14-3 2,4-Dichlorophenylthiourae
उत्पाद का नाम |
2,4-Dichlorophenylthiourae |
अंग्रेजी नाम |
2,4-Dichlorophenylthiourae; |
आणविक फार्मूला |
C7H6Cl2N2S |
आण्विक वजन |
221.1069 |
InChI |
InChI=1/C7H6Cl2N2S/c8-4-1-2-6(5(9)3-4)11-7(10)12/h1-3H,(H3,10,11,12) |
कैस रजिस्टी संख्या |
6326-14-3 |
आणविक संरचना |
|
घनत्व |
1.563g/cm3 |
उबलने का समय |
321.8°C at 760 mmHg |
अपवर्तक सूचकांक |
1.73 |
फ्लैश प्वाइंट |
148.4°C |
वाष्प का दबाव |
0.000292mmHg at 25°C |
खतरे के कोड |
R20/22:Harmful by inhalation and if swallowed.;
|
सुरक्षा विवरण |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|