ChemNet > CAS > 6326-14-3 2,4-Dichlorophenylthiourae
6326-14-3 2,4-Dichlorophenylthiourae
اسم المنتج |
2,4-Dichlorophenylthiourae |
الاسم بالانجليزية |
2,4-Dichlorophenylthiourae; |
الصيغة الجزيئية |
C7H6Cl2N2S |
الوزن الجزيئي الغرامي |
221.1069 |
InChI |
InChI=1/C7H6Cl2N2S/c8-4-1-2-6(5(9)3-4)11-7(10)12/h1-3H,(H3,10,11,12) |
إستراتيجية المساعدة القطرية |
6326-14-3 |
بنية جزيئية |
|
كثافة |
1.563g/cm3 |
نقطة الغليان |
321.8°C at 760 mmHg |
معامل الإنكسار |
1.73 |
نقطة الوميض |
148.4°C |
ضغط البخار |
0.000292mmHg at 25°C |
خطر المصطلحات |
R20/22:Harmful by inhalation and if swallowed.;
|
شروط الأمن |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|