ChemNet > CAS > 207981-50-8 2,6-difluoromandelic acid
207981-50-8 2,6-difluoromandelic acid
| उत्पाद का नाम |
2,6-difluoromandelic acid |
| समानार्थी |
alpha-Hydroxy-2,6-difluorophenylacetic acid; (2,6-difluorophenyl)(hydroxy)acetic acid |
| आणविक फार्मूला |
C8H6F2O3 |
| आण्विक वजन |
188.1282 |
| InChI |
InChI=1/C8H6F2O3/c9-4-2-1-3-5(10)6(4)7(11)8(12)13/h1-3,7,11H,(H,12,13) |
| कैस रजिस्टी संख्या |
207981-50-8 |
| आणविक संरचना |
|
| घनत्व |
1.522g/cm3 |
| उबलने का समय |
299.3°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.542 |
| फ्लैश प्वाइंट |
134.8°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
