ChemNet > CAS > 207981-50-8 2,6-difluoromandelic acid
207981-50-8 2,6-difluoromandelic acid
| Nome do produto |
2,6-difluoromandelic acid |
| Sinônimos |
alpha-Hydroxy-2,6-difluorophenylacetic acid; (2,6-difluorophenyl)(hydroxy)acetic acid |
| Fórmula molecular |
C8H6F2O3 |
| Peso Molecular |
188.1282 |
| InChI |
InChI=1/C8H6F2O3/c9-4-2-1-3-5(10)6(4)7(11)8(12)13/h1-3,7,11H,(H,12,13) |
| CAS Registry Number |
207981-50-8 |
| Estrutura Molecular |
|
| Densidade |
1.522g/cm3 |
| Ponto de ebulição |
299.3°C at 760 mmHg |
| índice de refração |
1.542 |
| O ponto de inflamação |
134.8°C |
| Símbolos de perigo |
|
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
