ChemNet > CAS > 207981-50-8 2,6-difluoromandelic acid
207981-50-8 2,6-difluoromandelic acid
Nama produk |
2,6-difluoromandelic acid |
Nama Inggeris |
2,6-difluoromandelic acid; alpha-Hydroxy-2,6-difluorophenylacetic acid; (2,6-difluorophenyl)(hydroxy)acetic acid |
MF |
C8H6F2O3 |
Berat Molekul |
188.1282 |
InChI |
InChI=1/C8H6F2O3/c9-4-2-1-3-5(10)6(4)7(11)8(12)13/h1-3,7,11H,(H,12,13) |
CAS NO |
207981-50-8 |
Struktur Molekul |
|
Kepadatan |
1.522g/cm3 |
Titik didih |
299.3°C at 760 mmHg |
Indeks bias |
1.542 |
Titik nyala |
134.8°C |
Tekanan wap |
0.000539mmHg at 25°C |
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|