ChemNet > CAS > 63139-21-9 4-Ethylphenylboronic acid
63139-21-9 4-Ethylphenylboronic acid
| उत्पाद का नाम |
4-Ethylphenylboronic acid |
| समानार्थी |
4-Ethylbenzeneboronic acid; P-Ethylphenylboronic acid; 4-Ethylphenyl boronic acid |
| आणविक फार्मूला |
C8H11BO2 |
| आण्विक वजन |
149.9827 |
| InChI |
InChI=1/C8H11BO2/c1-2-7-3-5-8(6-4-7)9(10)11/h3-6,10-11H,2H2,1H3 |
| कैस रजिस्टी संख्या |
63139-21-9 |
| आणविक संरचना |
|
| घनत्व |
1.07g/cm3 |
| गलनांक |
150-155℃ |
| उबलने का समय |
285.1°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.521 |
| फ्लैश प्वाइंट |
126.2°C |
| खतरा प्रतीक |
 Xi:Irritant;
|
| खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
