ChemNet > CAS > 63139-21-9 4-Ethylphenylboronic acid
63139-21-9 4-Ethylphenylboronic acid
उत्पाद का नाम |
4-Ethylphenylboronic acid |
समानार्थी |
4-Ethylbenzeneboronic acid; P-Ethylphenylboronic acid; 4-Ethylphenyl boronic acid |
आणविक फार्मूला |
C8H11BO2 |
आण्विक वजन |
149.9827 |
InChI |
InChI=1/C8H11BO2/c1-2-7-3-5-8(6-4-7)9(10)11/h3-6,10-11H,2H2,1H3 |
कैस रजिस्टी संख्या |
63139-21-9 |
आणविक संरचना |
|
घनत्व |
1.07g/cm3 |
गलनांक |
150-155℃ |
उबलने का समय |
285.1°C at 760 mmHg |
अपवर्तक सूचकांक |
1.521 |
फ्लैश प्वाइंट |
126.2°C |
खतरा प्रतीक |
Xi:Irritant;
|
खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|