ChemNet > CAS > 63139-21-9 4-Ethylphenylboronic acid
63139-21-9 4-Ethylphenylboronic acid
| Nome del prodotto |
4-Ethylphenylboronic acid |
| Sinonimi |
4-Ethylbenzeneboronic acid; P-Ethylphenylboronic acid; 4-Ethylphenyl boronic acid |
| Formula molecolare |
C8H11BO2 |
| Peso Molecolare |
149.9827 |
| InChI |
InChI=1/C8H11BO2/c1-2-7-3-5-8(6-4-7)9(10)11/h3-6,10-11H,2H2,1H3 |
| Numero CAS |
63139-21-9 |
| Struttura molecolare |
|
| Densità |
1.07g/cm3 |
| Punto di fusione |
150-155℃ |
| Punto di ebollizione |
285.1°C at 760 mmHg |
| Indice di rifrazione |
1.521 |
| Punto d'infiammabilità |
126.2°C |
| Simboli di pericolo |
 Xi:Irritant;
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
