ChemNet > CAS > 1483-27-8 2,5-Dimethoxythiophenol
1483-27-8 2,5-Dimethoxythiophenol
نام محصول |
2,5-Dimethoxythiophenol |
مترادف |
2,5-Dimethoxybenzenethiol |
میدان مغناطیسی |
C8H10O2S |
وزن مولکولی |
170.2288 |
InChI |
InChI=1/C8H10O2S/c1-9-6-3-4-7(10-2)8(11)5-6/h3-5,11H,1-2H3 |
شماره سیایاس |
1483-27-8 |
ساختار مولکولی |
|
تراکم |
1.134g/cm3 |
نقطه غلیان |
278.8°C at 760 mmHg |
ضریب شکست |
1.549 |
نقطه اشتعال |
122.4°C |
خطر نمادها |
|
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|