1483-27-8 2,5-Dimethoxythiophenol
Название продукта |
2,5-Dimethoxythiophenol |
Английское название |
2,5-Dimethoxythiophenol; 2,5-Dimethoxybenzenethiol |
Молекулярная формула |
C8H10O2S |
Молекулярный вес |
170.2288 |
InChI |
InChI=1/C8H10O2S/c1-9-6-3-4-7(10-2)8(11)5-6/h3-5,11H,1-2H3 |
Регистрационный номер CAS |
1483-27-8 |
Молекулярная структура |
|
Плотность |
1.134g/cm3 |
Точка кипения |
278.8°C at 760 mmHg |
Показатель преломления |
1.549 |
Температура вспышки |
122.4°C |
Давление пара |
0.00707mmHg at 25°C |
Риск коды |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|