ChemNet > CAS > 18355-75-4 2,3-difluorobenzamide
18355-75-4 2,3-difluorobenzamide
| نام محصول |
2,3-difluorobenzamide |
| مترادف |
2,3-Difluorobenzamide |
| میدان مغناطیسی |
C7H5F2NO |
| وزن مولکولی |
157.1175 |
| InChI |
InChI=1/C7H5F2NO/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3H,(H2,10,11) |
| شماره سیایاس |
18355-75-4 |
| ساختار مولکولی |
|
| تراکم |
1.348g/cm3 |
| نقطه غلیان |
197°C at 760 mmHg |
| ضریب شکست |
1.515 |
| نقطه اشتعال |
73°C |
| خطر نمادها |
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
