ChemNet > CAS > 18355-75-4 2,3-difluorobenzamide
18355-75-4 2,3-difluorobenzamide
Nazwa produktu: |
2,3-difluorobenzamide |
Synonimy |
2,3-Difluorobenzamide |
MF |
C7H5F2NO |
Masie cząsteczkowej |
157.1175 |
InChI |
InChI=1/C7H5F2NO/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3H,(H2,10,11) |
Nr CAS |
18355-75-4 |
Struktury molekularnej |
|
Gęstość |
1.348g/cm3 |
Temperatura wrzenia |
197°C at 760 mmHg |
Współczynnik załamania |
1.515 |
Temperatura zapłonu |
73°C |
Symbole zagrożenia |
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|