18355-75-4 2,3-difluorobenzamide
اسم المنتج |
2,3-difluorobenzamide |
الاسم بالانجليزية |
2,3-difluorobenzamide;2,3-Difluorobenzamide |
الصيغة الجزيئية |
C7H5F2NO |
الوزن الجزيئي الغرامي |
157.1175 |
InChI |
InChI=1/C7H5F2NO/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3H,(H2,10,11) |
إستراتيجية المساعدة القطرية |
18355-75-4 |
بنية جزيئية |
|
كثافة |
1.348g/cm3 |
نقطة الغليان |
197°C at 760 mmHg |
معامل الإنكسار |
1.515 |
نقطة الوميض |
73°C |
ضغط البخار |
0.387mmHg at 25°C |
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|