ChemNet > CAS > 40803-53-0 5-Bromo-2-methoxycinnamic acid
40803-53-0 5-Bromo-2-methoxycinnamic acid
| Nome del prodotto |
5-Bromo-2-methoxycinnamic acid |
| Nome inglese |
5-Bromo-2-methoxycinnamic acid;(2E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoic acid; (2E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoate |
| Formula molecolare |
C10H8BrO3 |
| Peso Molecolare |
256.0733 |
| InChI |
InChI=1/C10H9BrO3/c1-14-9-4-3-8(11)6-7(9)2-5-10(12)13/h2-6H,1H3,(H,12,13)/p-1/b5-2+ |
| Numero CAS |
40803-53-0 |
| Struttura molecolare |
|
| Punto di fusione |
224-227℃ |
| Punto di ebollizione |
381.5°C at 760 mmHg |
| Punto d'infiammabilità |
184.5°C |
| Pressione di vapore |
1.68E-06mmHg at 25°C |
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|