ChemNet > CAS > 201058-08-4 Wang resin
201058-08-4 Wang resin
상품명칭 |
Wang resin |
별명 |
4-Benzyloxybenzyl alcohol, polymer-supported~Polystyrene PHB; [4-(Hydroxymethyl)phenoxymethyl]polystyrene divinylbenzene copolymer; {4-[(4-methylbenzyl)oxy]phenyl}methanol |
분자식 |
C15H16O2 |
분자량 |
228.2863 |
InChI |
InChI=1/C15H16O2/c1-12-2-4-14(5-3-12)11-17-15-8-6-13(10-16)7-9-15/h2-9,16H,10-11H2,1H3 |
cas번호 |
201058-08-4 |
분자 구조 |
|
밀도 |
1.117g/cm3 |
비등점 |
386.2°C at 760 mmHg |
굴절 지수 |
1.587 |
인화점 |
175.2°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|