ChemNet > CAS > 2905-69-3 Methyl 2,5-dichlorobenzoate
2905-69-3 Methyl 2,5-dichlorobenzoate
Nama produk |
Methyl 2,5-dichlorobenzoate |
Sinonim |
2,5-Dichlorobenzoic acid methyl ester |
MF |
C8H6Cl2O2 |
Berat Molekul |
205.038 |
InChI |
InChI=1/C8H6Cl2O2/c1-12-8(11)6-4-5(9)2-3-7(6)10/h2-4H,1H3 |
CAS NO |
2905-69-3 |
EINECS |
220-815-7 |
Struktur Molekul |
|
Kepadatan |
1.355g/cm3 |
Titik didih |
265.2°C at 760 mmHg |
Indeks bias |
1.545 |
Titik nyala |
113.2°C |
Cinta bahaya |
|
Kod Risiko |
|
Keselamatan Penerangan |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|