ChemNet > CAS > 2905-69-3 Methyl 2,5-dichlorobenzoate
2905-69-3 Methyl 2,5-dichlorobenzoate
| Naam product |
Methyl 2,5-dichlorobenzoate |
| Synoniemen |
2,5-Dichlorobenzoic acid methyl ester |
| MF |
C8H6Cl2O2 |
| Molecuulgewicht |
205.038 |
| InChI |
InChI=1/C8H6Cl2O2/c1-12-8(11)6-4-5(9)2-3-7(6)10/h2-4H,1H3 |
| CAS-nummer |
2905-69-3 |
| EINECS |
220-815-7 |
| Moleculaire Structuur |
|
| Dichtheid |
1.355g/cm3 |
| Kookpunt |
265.2°C at 760 mmHg |
| Brekingsindex |
1.545 |
| Vlampunt |
113.2°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
