ChemNet > CAS > 14309-57-0 3-Nonen-2-one
14309-57-0 3-Nonen-2-one
Naam product |
3-Nonen-2-one |
Synoniemen |
non-3-en-2-one; (3E)-non-3-en-2-one; (3Z)-non-3-en-2-one |
MF |
C9H16O |
Molecuulgewicht |
140.2227 |
InChI |
InChI=1/C9H16O/c1-3-4-5-6-7-8-9(2)10/h7-8H,3-6H2,1-2H3/b8-7- |
CAS-nummer |
14309-57-0 |
EINECS |
238-248-9 |
Moleculaire Structuur |
|
Dichtheid |
0.835g/cm3 |
Kookpunt |
201.9°C at 760 mmHg |
Brekingsindex |
1.435 |
Vlampunt |
81.3°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37:Irritating to eyes and respiratory system.;
|
Veiligheid Omschrijving |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|