ChemNet > CAS > 14309-57-0 3-Nonen-2-one
14309-57-0 3-Nonen-2-one
| produktnavn |
3-Nonen-2-one |
| Synonymer |
non-3-en-2-one; (3E)-non-3-en-2-one; (3Z)-non-3-en-2-one |
| Molekylær Formel |
C9H16O |
| Molekylvekt |
140.2227 |
| InChI |
InChI=1/C9H16O/c1-3-4-5-6-7-8-9(2)10/h7-8H,3-6H2,1-2H3/b8-7- |
| CAS-nummer |
14309-57-0 |
| EINECS |
238-248-9 |
| Molecular Structure |
|
| Tetthet |
0.835g/cm3 |
| Kokepunkt |
201.9°C at 760 mmHg |
| Brytningsindeks |
1.435 |
| Flammepunktet |
81.3°C |
| Hazard symboler |
|
| Risiko Koder |
R36/37:Irritating to eyes and respiratory system.;
|
| Sikkerhet Beskrivelse |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
