ChemNet > CAS > 19547-88-7 N,S-diacetyl-L-cysteine methyl ester
19547-88-7 N,S-diacetyl-L-cysteine methyl ester
Naam product |
N,S-diacetyl-L-cysteine methyl ester |
Synoniemen |
N,S-Diacetylcysteine methyl ester; Methyl N,S-diacetyl-L-cysteinate |
MF |
C8H13NO4S |
Molecuulgewicht |
219.2581 |
InChI |
InChI=1/C8H13NO4S/c1-5(10)9-7(8(12)13-3)4-14-6(2)11/h7H,4H2,1-3H3,(H,9,10)/t7-/m0/s1 |
CAS-nummer |
19547-88-7 |
EINECS |
243-146-2 |
Moleculaire Structuur |
|
Dichtheid |
1.208g/cm3 |
Smeltpunt |
97-100℃ |
Kookpunt |
379.4°C at 760 mmHg |
Brekingsindex |
1.49 |
Vlampunt |
183.3°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|