ChemNet > CAS > 3760-11-0 2-Nonenoic acid
3760-11-0 2-Nonenoic acid
| produktnavn |
2-Nonenoic acid |
| Synonymer |
trans-2-Nonenoic acid; (2Z)-non-2-enoic acid |
| Molekylær Formel |
C9H16O2 |
| Molekylvekt |
156.2221 |
| InChI |
InChI=1/C9H16O2/c1-2-3-4-5-6-7-8-9(10)11/h7-8H,2-6H2,1H3,(H,10,11)/b8-7- |
| CAS-nummer |
3760-11-0 |
| EINECS |
223-171-5 |
| Molecular Structure |
|
| Tetthet |
0.944g/cm3 |
| Kokepunkt |
261.5°C at 760 mmHg |
| Brytningsindeks |
1.46 |
| Flammepunktet |
168.3°C |
| Hazard symboler |
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
