5949-05-3 L(-)-Citronellal
Nazwa produktu: |
L(-)-Citronellal |
Synonimy |
;(S)-(-)-3,7-dimetylo-6-oktenal; (S)-()-Citronellal; Citrnellal; (-)-Citrnellal; (3S)-3,7-dimetylokt-6-enal; (-)-Citronellal |
Angielska nazwa |
L(-)-Citronellal; (S)-(-)-3,7-Dimethyl-6-octenal; (S)-()-Citronellal; Citrnellal; (-)-Citrnellal; (3S)-3,7-dimethyloct-6-enal; (-)-Citronellal |
MF |
C10H18O |
Masie cząsteczkowej |
154.2493 |
InChI |
InChI=1/C10H18O/c1-9(2)5-4-6-10(3)7-8-11/h5,8,10H,4,6-7H2,1-3H3/t10-/m0/s1 |
Nr CAS |
5949-05-3 |
EINECS |
227-707-9 |
Struktury molekularnej |
|
Gęstość |
0.835g/cm3 |
Temperatura wrzenia |
208.4°C at 760 mmHg |
Współczynnik załamania |
1.437 |
Temperatura zapłonu |
75.6°C |
Ciśnienie pary |
0.215mmHg at 25°C |
Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|