ChemNet > CAS > 29681-45-6 Methyl 5-methylnicotinate
29681-45-6 Methyl 5-methylnicotinate
| اسم المنتج |
Methyl 5-methylnicotinate |
| الاسم المستعار |
Methyl 5-methylpyridine-3-carboxylate; 5-Methylnicotinic acid methyl ester; 5-Methyl-nicotinic acid methyl ester |
| الصيغة الجزيئية |
C8H9NO2 |
| الوزن الجزيئي الغرامي |
151.1626 |
| InChI |
InChI=1/C8H9NO2/c1-6-3-7(5-9-4-6)8(10)11-2/h3-5H,1-2H3 |
| إستراتيجية المساعدة القطرية |
29681-45-6 |
| بنية جزيئية |
|
| كثافة |
1.104g/cm3 |
| نقطة الغليان |
228.5°C at 760 mmHg |
| معامل الإنكسار |
1.51 |
| نقطة الوميض |
92°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
