ChemNet > CAS > 4640-68-0 3,4-Dichlorobenzoylacetonitrile
4640-68-0 3,4-Dichlorobenzoylacetonitrile
Ürün Adı |
3,4-Dichlorobenzoylacetonitrile |
ingilizce adı |
3,4-Dichlorobenzoylacetonitrile;3-(3,4-dichlorophenyl)-3-oxopropanenitrile |
Moleküler Formülü |
C9H5Cl2NO |
Molekül Ağırlığı |
214.0481 |
InChI |
InChI=1/C9H5Cl2NO/c10-7-2-1-6(5-8(7)11)9(13)3-4-12/h1-2,5H,3H2 |
CAS kayıt numarası |
4640-68-0 |
Moleküler Yapısı |
|
Yoğunluk |
1.383g/cm3 |
Kaynama noktası |
398.4°C at 760 mmHg |
Kırılma indisi |
1.567 |
Alevlenme noktası |
194.7°C |
Buhar basıncı |
1.48E-06mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|