ChemNet > CAS > 2049-67-4 diethyl glutaconate, mixture of cis and tra
2049-67-4 diethyl glutaconate, mixture of cis and tra
název výrobku |
diethyl glutaconate, mixture of cis and tra |
Synonyma |
Diethyl glutaconate,mixture of cis and trans; diethyl pent-2-enedioate; diethyl (2E)-pent-2-enedioate; diethyl (2Z)-pent-2-enedioate; 2-Pentenedioic acid,1,5-diethyl ester; Diethyl glutaconate |
Molekulární vzorec |
C9H14O4 |
Molekulová hmotnost |
186.2051 |
InChI |
InChI=1/C9H14O4/c1-3-12-8(10)6-5-7-9(11)13-4-2/h5-6H,3-4,7H2,1-2H3/b6-5- |
Registrační číslo CAS |
2049-67-4 |
EINECS |
218-069-2 |
Molekulární struktura |
|
Hustota |
1.048g/cm3 |
Bod varu |
237°C at 760 mmHg |
Index lomu |
1.445 |
Bod vzplanutí |
106.7°C |
Symbolů nebezpečnosti |
|
Riziko Codes |
|
Bezpečnostní Popis |
|
|