ChemNet > CAS > 2049-67-4 diethyl glutaconate, mixture of cis and tra
2049-67-4 diethyl glutaconate, mixture of cis and tra
termék neve |
diethyl glutaconate, mixture of cis and tra |
Szinonimák |
Diethyl glutaconate,mixture of cis and trans; diethyl pent-2-enedioate; diethyl (2E)-pent-2-enedioate; diethyl (2Z)-pent-2-enedioate; 2-Pentenedioic acid,1,5-diethyl ester; Diethyl glutaconate |
MF |
C9H14O4 |
Molekulatömeg |
186.2051 |
InChI |
InChI=1/C9H14O4/c1-3-12-8(10)6-5-7-9(11)13-4-2/h5-6H,3-4,7H2,1-2H3/b6-5- |
CAS-szám |
2049-67-4 |
EINECS |
218-069-2 |
Molekuláris szerkezete |
|
Sűrűség |
1.048g/cm3 |
Forráspont |
237°C at 760 mmHg |
Törésmutató |
1.445 |
Gyulladáspont |
106.7°C |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
|
|