ChemNet > CAS > 2049-67-4 diethyl glutaconate, mixture of cis and tra
2049-67-4 diethyl glutaconate, mixture of cis and tra
| termék neve |
diethyl glutaconate, mixture of cis and tra |
| Szinonimák |
Diethyl glutaconate,mixture of cis and trans; diethyl pent-2-enedioate; diethyl (2E)-pent-2-enedioate; diethyl (2Z)-pent-2-enedioate; 2-Pentenedioic acid,1,5-diethyl ester; Diethyl glutaconate |
| MF |
C9H14O4 |
| Molekulatömeg |
186.2051 |
| InChI |
InChI=1/C9H14O4/c1-3-12-8(10)6-5-7-9(11)13-4-2/h5-6H,3-4,7H2,1-2H3/b6-5- |
| CAS-szám |
2049-67-4 |
| EINECS |
218-069-2 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.048g/cm3 |
| Forráspont |
237°C at 760 mmHg |
| Törésmutató |
1.445 |
| Gyulladáspont |
106.7°C |
| Veszély szimbólumok |
|
| Kockázatot kódok |
|
| Biztonsági Leírás |
|
|
