ChemNet > CAS > 2049-67-4 diethyl glutaconate, mixture of cis and tra
2049-67-4 diethyl glutaconate, mixture of cis and tra
उत्पाद का नाम |
diethyl glutaconate, mixture of cis and tra |
समानार्थी |
Diethyl glutaconate,mixture of cis and trans; diethyl pent-2-enedioate; diethyl (2E)-pent-2-enedioate; diethyl (2Z)-pent-2-enedioate; 2-Pentenedioic acid,1,5-diethyl ester; Diethyl glutaconate |
आणविक फार्मूला |
C9H14O4 |
आण्विक वजन |
186.2051 |
InChI |
InChI=1/C9H14O4/c1-3-12-8(10)6-5-7-9(11)13-4-2/h5-6H,3-4,7H2,1-2H3/b6-5- |
कैस रजिस्टी संख्या |
2049-67-4 |
EINECS |
218-069-2 |
आणविक संरचना |
|
घनत्व |
1.048g/cm3 |
उबलने का समय |
237°C at 760 mmHg |
अपवर्तक सूचकांक |
1.445 |
फ्लैश प्वाइंट |
106.7°C |
खतरा प्रतीक |
|
खतरे के कोड |
|
सुरक्षा विवरण |
|
|