ChemNet > CAS > 2049-67-4 diethyl glutaconate, mixture of cis and tra
2049-67-4 diethyl glutaconate, mixture of cis and tra
نام محصول |
diethyl glutaconate, mixture of cis and tra |
مترادف |
Diethyl glutaconate,mixture of cis and trans; diethyl pent-2-enedioate; diethyl (2E)-pent-2-enedioate; diethyl (2Z)-pent-2-enedioate; 2-Pentenedioic acid,1,5-diethyl ester; Diethyl glutaconate |
میدان مغناطیسی |
C9H14O4 |
وزن مولکولی |
186.2051 |
InChI |
InChI=1/C9H14O4/c1-3-12-8(10)6-5-7-9(11)13-4-2/h5-6H,3-4,7H2,1-2H3/b6-5- |
شماره سیایاس |
2049-67-4 |
تعداد کمیسیون اروپایی |
218-069-2 |
ساختار مولکولی |
|
تراکم |
1.048g/cm3 |
نقطه غلیان |
237°C at 760 mmHg |
ضریب شکست |
1.445 |
نقطه اشتعال |
106.7°C |
خطر نمادها |
|
کدهای خطر |
|
توضیحات ایمنی |
|
|