1193-82-4 Methyl phenyl sulfoxide
Produkt-Name |
Methyl phenyl sulfoxide |
Englischer Name |
Methyl phenyl sulfoxide; Methyl phenyl sulphoxide; (methylsulfinyl)benzene |
Molekulare Formel |
C7H8OS |
Molecular Weight |
140.2028 |
InChI |
InChI=1/C7H8OS/c1-9(8)7-5-3-2-4-6-7/h2-6H,1H3 |
CAS Registry Number |
1193-82-4 |
EINECS |
214-781-2 |
Molecular Structure |
|
Dichte |
1.19g/cm3 |
Schmelzpunkt |
34-94℃ |
Siedepunkt |
271.2°C at 760 mmHg |
Brechungsindex |
1.605 |
Flammpunkt |
117.8°C |
Dampfdruck |
0.0109mmHg at 25°C |
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|