ChemNet > CAS > 1193-82-4 Methyl phenyl sulfoxide
1193-82-4 Methyl phenyl sulfoxide
| Nama produk |
Methyl phenyl sulfoxide |
| Sinonim |
Methyl phenyl sulphoxide; (methylsulfinyl)benzene |
| MF |
C7H8OS |
| Berat Molekul |
140.2028 |
| InChI |
InChI=1/C7H8OS/c1-9(8)7-5-3-2-4-6-7/h2-6H,1H3 |
| CAS NO |
1193-82-4 |
| EINECS |
214-781-2 |
| Struktur Molekul |
|
| Kepadatan |
1.19g/cm3 |
| Titik lebur |
34-94℃ |
| Titik didih |
271.2°C at 760 mmHg |
| Indeks bias |
1.605 |
| Titik nyala |
117.8°C |
| Cinta bahaya |
|
| Kod Risiko |
|
| Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|
