1193-82-4 Methyl phenyl sulfoxide
Naam product |
Methyl phenyl sulfoxide |
Engelse naam |
Methyl phenyl sulfoxide; Methyl phenyl sulphoxide; (methylsulfinyl)benzene |
MF |
C7H8OS |
Molecuulgewicht |
140.2028 |
InChI |
InChI=1/C7H8OS/c1-9(8)7-5-3-2-4-6-7/h2-6H,1H3 |
CAS-nummer |
1193-82-4 |
EINECS |
214-781-2 |
Moleculaire Structuur |
|
Dichtheid |
1.19g/cm3 |
Smeltpunt |
34-94℃ |
Kookpunt |
271.2°C at 760 mmHg |
Brekingsindex |
1.605 |
Vlampunt |
117.8°C |
Dampdruk |
0.0109mmHg at 25°C |
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|