ChemNet > CAS > 1193-82-4 Methyl phenyl sulfoxide
1193-82-4 Methyl phenyl sulfoxide
| Nome do produto |
Methyl phenyl sulfoxide |
| Sinônimos |
Methyl phenyl sulphoxide; (methylsulfinyl)benzene |
| Fórmula molecular |
C7H8OS |
| Peso Molecular |
140.2028 |
| InChI |
InChI=1/C7H8OS/c1-9(8)7-5-3-2-4-6-7/h2-6H,1H3 |
| CAS Registry Number |
1193-82-4 |
| EINECS |
214-781-2 |
| Estrutura Molecular |
|
| Densidade |
1.19g/cm3 |
| Ponto de fusão |
34-94℃ |
| Ponto de ebulição |
271.2°C at 760 mmHg |
| índice de refração |
1.605 |
| O ponto de inflamação |
117.8°C |
| Símbolos de perigo |
|
| Códigos de risco |
|
| Descrição da Segurança |
S24/25:Avoid contact with skin and eyes.;
|
|
