ChemNet > CAS > 1551-44-6 cyclohexyl butyrate
1551-44-6 cyclohexyl butyrate
| Produkt-Name |
cyclohexyl butyrate |
| Synonyme |
Cyclohexyl butyrate,(Butyric acid cyclohexyl ester); Butyric acid cyclohexyl ester; cyclohexyl butanoate |
| Molekulare Formel |
C10H18O2 |
| Molecular Weight |
170.2487 |
| InChI |
InChI=1/C10H18O2/c1-2-6-10(11)12-9-7-4-3-5-8-9/h9H,2-8H2,1H3 |
| CAS Registry Number |
1551-44-6 |
| EINECS |
216-290-9 |
| Molecular Structure |
|
| Dichte |
0.94g/cm3 |
| Siedepunkt |
214.9°C at 760 mmHg |
| Brechungsindex |
1.449 |
| Flammpunkt |
78°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
