1551-44-6 cyclohexyl butyrate
| Nome do produto |
cyclohexyl butyrate |
| Nome em inglês |
cyclohexyl butyrate; Cyclohexyl butyrate,(Butyric acid cyclohexyl ester); Butyric acid cyclohexyl ester; cyclohexyl butanoate |
| Fórmula molecular |
C10H18O2 |
| Peso Molecular |
170.2487 |
| InChI |
InChI=1/C10H18O2/c1-2-6-10(11)12-9-7-4-3-5-8-9/h9H,2-8H2,1H3 |
| CAS Registry Number |
1551-44-6 |
| EINECS |
216-290-9 |
| Estrutura Molecular |
|
| Densidade |
0.94g/cm3 |
| Ponto de ebulição |
214.9°C at 760 mmHg |
| índice de refração |
1.449 |
| O ponto de inflamação |
78°C |
| Pressão de vapor |
0.152mmHg at 25°C |
| Descrição da Segurança |
S24/25:Avoid contact with skin and eyes.;
|
|