ChemNet > CAS > 38985-72-7 4-(2-Fluorophenyl)thiosemicarbazide
38985-72-7 4-(2-Fluorophenyl)thiosemicarbazide
Ονομασία του προϊόντος |
4-(2-Fluorophenyl)thiosemicarbazide |
Αγγλικό όνομα |
4-(2-Fluorophenyl)thiosemicarbazide; 4-(2-Fluorophenyl)-3-thiosemicarbazide; N-(2-fluorophenyl)hydrazinecarbothioamide |
MF |
C7H8FN3S |
Μοριακό βάρος |
185.2219 |
InChI |
InChI=1/C7H8FN3S/c8-5-3-1-2-4-6(5)10-7(12)11-9/h1-4H,9H2,(H2,10,11,12) |
CAS ΟΧΙ |
38985-72-7 |
Μοριακή δομή |
|
Πυκνότητα |
1.418g/cm3 |
Σημείο τήξης |
159-160℃ |
Σημείο βρασμού |
278.2°C at 760 mmHg |
Δείκτης διάθλασης |
1.696 |
Σημείο ανάφλεξης |
122°C |
Πίεση ατμών |
0.00433mmHg at 25°C |
Κινδύνου Κώδικες |
R25:Toxic if swallowed.;
|
Περιγραφή της ασφάλειας |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|