ChemNet > CAS > 38985-72-7 4-(2-Fluorophenyl)thiosemicarbazide
38985-72-7 4-(2-Fluorophenyl)thiosemicarbazide
Nazwa produktu: |
4-(2-Fluorophenyl)thiosemicarbazide |
Angielska nazwa |
4-(2-Fluorophenyl)thiosemicarbazide; 4-(2-Fluorophenyl)-3-thiosemicarbazide; N-(2-fluorophenyl)hydrazinecarbothioamide |
MF |
C7H8FN3S |
Masie cząsteczkowej |
185.2219 |
InChI |
InChI=1/C7H8FN3S/c8-5-3-1-2-4-6(5)10-7(12)11-9/h1-4H,9H2,(H2,10,11,12) |
Nr CAS |
38985-72-7 |
Struktury molekularnej |
|
Gęstość |
1.418g/cm3 |
Temperatura topnienia |
159-160℃ |
Temperatura wrzenia |
278.2°C at 760 mmHg |
Współczynnik załamania |
1.696 |
Temperatura zapłonu |
122°C |
Ciśnienie pary |
0.00433mmHg at 25°C |
Kody ryzyka |
R25:Toxic if swallowed.;
|
Bezpieczeństwo opis |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|