ChemNet > CAS > 38985-72-7 4-(2-Fluorophenyl)thiosemicarbazide
38985-72-7 4-(2-Fluorophenyl)thiosemicarbazide
نام محصول |
4-(2-Fluorophenyl)thiosemicarbazide |
نام انگلیسی |
4-(2-Fluorophenyl)thiosemicarbazide; 4-(2-Fluorophenyl)-3-thiosemicarbazide; N-(2-fluorophenyl)hydrazinecarbothioamide |
میدان مغناطیسی |
C7H8FN3S |
وزن مولکولی |
185.2219 |
InChI |
InChI=1/C7H8FN3S/c8-5-3-1-2-4-6(5)10-7(12)11-9/h1-4H,9H2,(H2,10,11,12) |
شماره سیایاس |
38985-72-7 |
ساختار مولکولی |
|
تراکم |
1.418g/cm3 |
نقطه ذوب |
159-160℃ |
نقطه غلیان |
278.2°C at 760 mmHg |
ضریب شکست |
1.696 |
نقطه اشتعال |
122°C |
فشار بخار |
0.00433mmHg at 25°C |
کدهای خطر |
R25:Toxic if swallowed.;
|
توضیحات ایمنی |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|