ChemNet > CAS > 38985-72-7 4-(2-Fluorophenyl)thiosemicarbazide
38985-72-7 4-(2-Fluorophenyl)thiosemicarbazide
Nama produk |
4-(2-Fluorophenyl)thiosemicarbazide |
Nama Inggeris |
4-(2-Fluorophenyl)thiosemicarbazide; 4-(2-Fluorophenyl)-3-thiosemicarbazide; N-(2-fluorophenyl)hydrazinecarbothioamide |
MF |
C7H8FN3S |
Berat Molekul |
185.2219 |
InChI |
InChI=1/C7H8FN3S/c8-5-3-1-2-4-6(5)10-7(12)11-9/h1-4H,9H2,(H2,10,11,12) |
CAS NO |
38985-72-7 |
Struktur Molekul |
|
Kepadatan |
1.418g/cm3 |
Titik lebur |
159-160℃ |
Titik didih |
278.2°C at 760 mmHg |
Indeks bias |
1.696 |
Titik nyala |
122°C |
Tekanan wap |
0.00433mmHg at 25°C |
Kod Risiko |
R25:Toxic if swallowed.;
|
Keselamatan Penerangan |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|