ChemNet > CAS > 39943-56-1 3,5-Dichlorophenylhydrazine
39943-56-1 3,5-Dichlorophenylhydrazine
Ονομασία του προϊόντος |
3,5-Dichlorophenylhydrazine |
Αγγλικό όνομα |
3,5-Dichlorophenylhydrazine; |
MF |
C6H6Cl2N2 |
Μοριακό βάρος |
177.0312 |
InChI |
InChI=1/C6H6Cl2N2/c7-4-1-5(8)3-6(2-4)10-9/h1-3,10H,9H2 |
CAS ΟΧΙ |
39943-56-1 |
Μοριακή δομή |
|
Πυκνότητα |
1.475g/cm3 |
Σημείο βρασμού |
286.1°C at 760 mmHg |
Δείκτης διάθλασης |
1.665 |
Σημείο ανάφλεξης |
126.8°C |
Πίεση ατμών |
0.0027mmHg at 25°C |
Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Περιγραφή της ασφάλειας |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|